C19H25NO — CID 117455796
1-(3,3-dimethylcyclohexyl)-4-(1-isocyanatocyclobutyl)benzene (PubChem CID 117455796) has the molecular formula C19H25NO and a molecular weight of 283.41 g/mol. Its IUPAC name is 1-(3,3-dimethylcyclohexyl)-4-(1-isocyanatocyclobutyl)benzene.
| Compound Name | 1-(3,3-dimethylcyclohexyl)-4-(1-isocyanatocyclobutyl)benzene |
|---|---|
| PubChem CID | 117455796 |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | 1-(3,3-dimethylcyclohexyl)-4-(1-isocyanatocyclobutyl)benzene |
| SMILES | CC1(C)CCCC(c2ccc(C3(N=C=O)CCC3)cc2)C1 |
| InChI | InChI=1S/C19H25NO/c1-18(2)10-3-5-16(13-18)15-6-8-17(9-7-15)19(20-14-21)11-4-12-19/h6-9,16H,3-5,10-13H2,1-2H3 |
| InChIKey | VPJGHSSRJMFQIS-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|