C20H27NO — CID 117479141
1-(4,4-dimethylcyclohexyl)-4-(1-isocyanatocyclopentyl)benzene (PubChem CID 117479141) has the molecular formula C20H27NO and a molecular weight of 297.44 g/mol. Its IUPAC name is 1-(4,4-dimethylcyclohexyl)-4-(1-isocyanatocyclopentyl)benzene.
| Compound Name | 1-(4,4-dimethylcyclohexyl)-4-(1-isocyanatocyclopentyl)benzene |
|---|---|
| PubChem CID | 117479141 |
| Molecular Formula | C20H27NO |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | 1-(4,4-dimethylcyclohexyl)-4-(1-isocyanatocyclopentyl)benzene |
| SMILES | CC1(C)CCC(c2ccc(C3(N=C=O)CCCC3)cc2)CC1 |
| InChI | InChI=1S/C20H27NO/c1-19(2)13-9-17(10-14-19)16-5-7-18(8-6-16)20(21-15-22)11-3-4-12-20/h5-8,17H,3-4,9-14H2,1-2H3 |
| InChIKey | XARLBWIYZILANH-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|