C18H26O — CID 117399936
3-[4-(3,3-dimethylcyclohexyl)phenyl]butanal (PubChem CID 117399936) has the molecular formula C18H26O and a molecular weight of 258.41 g/mol. Its IUPAC name is 3-[4-(3,3-dimethylcyclohexyl)phenyl]butanal.
| Compound Name | 3-[4-(3,3-dimethylcyclohexyl)phenyl]butanal |
|---|---|
| PubChem CID | 117399936 |
| Molecular Formula | C18H26O |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | 3-[4-(3,3-dimethylcyclohexyl)phenyl]butanal |
| SMILES | CC(CC=O)c1ccc(C2CCCC(C)(C)C2)cc1 |
| InChI | InChI=1S/C18H26O/c1-14(10-12-19)15-6-8-16(9-7-15)17-5-4-11-18(2,3)13-17/h6-9,12,14,17H,4-5,10-11,13H2,1-3H3 |
| InChIKey | CSUKUUMFNNXLDI-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|