About 3-(4-iodophenyl)butanal
3-(4-iodophenyl)butanal (PubChem CID 101197273) has the molecular formula C10H11IO
and a molecular weight of 274.10 g/mol. Its IUPAC name is 3-(4-iodophenyl)butanal.
Molecular Properties
| Compound Name | 3-(4-iodophenyl)butanal |
| PubChem CID | 101197273 |
| Molecular Formula | C10H11IO |
| Molecular Weight | 274.10 g/mol |
| Exact Mass | 273.99 |
| IUPAC Name | 3-(4-iodophenyl)butanal |
| SMILES | CC(CC=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C10H11IO/c1-8(6-7-12)9-2-4-10(11)5-3-9/h2-5,7-8H,6H2,1H3 |
| InChIKey | ZWJIBNMLDGPNIR-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.10 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-iodophenyl)butanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-iodophenyl)butanal?
The IUPAC name of 3-(4-iodophenyl)butanal (CID 101197273) is 3-(4-iodophenyl)butanal.
What is the SMILES notation for 3-(4-iodophenyl)butanal?
The canonical SMILES for 3-(4-iodophenyl)butanal is CC(CC=O)c1ccc(I)cc1.
What is the InChIKey of 3-(4-iodophenyl)butanal?
The InChIKey is ZWJIBNMLDGPNIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11IO/c1-8(6-7-12)9-2-4-10(11)5-3-9/h2-5,7-8H,6H2,1H3.
What are the key properties of 3-(4-iodophenyl)butanal?
3-(4-iodophenyl)butanal has a molecular weight of 274.10 g/mol, XLogP of 2.98, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-iodophenyl)butanal is sourced from PubChem (CID 101197273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).