About aniline;ethane;3-phenylbutanal
aniline;ethane;3-phenylbutanal (PubChem CID 172564179) has the molecular formula C18H25NO
and a molecular weight of 271.40 g/mol. Its IUPAC name is aniline;ethane;3-phenylbutanal.
Molecular Properties
| Compound Name | aniline;ethane;3-phenylbutanal |
| PubChem CID | 172564179 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | aniline;ethane;3-phenylbutanal |
| SMILES | CC.CC(CC=O)c1ccccc1.Nc1ccccc1 |
| InChI | InChI=1S/C10H12O.C6H7N.C2H6/c1-9(7-8-11)10-5-3-2-4-6-10;7-6-4-2-1-3-5-6;1-2/h2-6,8-9H,7H2,1H3;1-5H,7H2;1-2H3 |
| InChIKey | GASWSZFTLNLCIA-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze aniline;ethane;3-phenylbutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aniline;ethane;3-phenylbutanal?
The IUPAC name of aniline;ethane;3-phenylbutanal (CID 172564179) is aniline;ethane;3-phenylbutanal.
What is the SMILES notation for aniline;ethane;3-phenylbutanal?
The canonical SMILES for aniline;ethane;3-phenylbutanal is CC.CC(CC=O)c1ccccc1.Nc1ccccc1.
What is the InChIKey of aniline;ethane;3-phenylbutanal?
The InChIKey is GASWSZFTLNLCIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O.C6H7N.C2H6/c1-9(7-8-11)10-5-3-2-4-6-10;7-6-4-2-1-3-5-6;1-2/h2-6,8-9H,7H2,1H3;1-5H,7H2;1-2H3.
What are the key properties of aniline;ethane;3-phenylbutanal?
aniline;ethane;3-phenylbutanal has a molecular weight of 271.40 g/mol, XLogP of 4.67, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for aniline;ethane;3-phenylbutanal is sourced from PubChem (CID 172564179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).