About 3-(4-aminophenyl)butanal
3-(4-aminophenyl)butanal (PubChem CID 143206837) has the molecular formula C10H13NO
and a molecular weight of 163.22 g/mol. Its IUPAC name is 3-(4-aminophenyl)butanal.
Molecular Properties
| Compound Name | 3-(4-aminophenyl)butanal |
| PubChem CID | 143206837 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 3-(4-aminophenyl)butanal |
| SMILES | CC(CC=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C10H13NO/c1-8(6-7-12)9-2-4-10(11)5-3-9/h2-5,7-8H,6,11H2,1H3 |
| InChIKey | SSVDUOLXGGKAGQ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-aminophenyl)butanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-aminophenyl)butanal?
The IUPAC name of 3-(4-aminophenyl)butanal (CID 143206837) is 3-(4-aminophenyl)butanal.
What is the SMILES notation for 3-(4-aminophenyl)butanal?
The canonical SMILES for 3-(4-aminophenyl)butanal is CC(CC=O)c1ccc(N)cc1.
What is the InChIKey of 3-(4-aminophenyl)butanal?
The InChIKey is SSVDUOLXGGKAGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO/c1-8(6-7-12)9-2-4-10(11)5-3-9/h2-5,7-8H,6,11H2,1H3.
What are the key properties of 3-(4-aminophenyl)butanal?
3-(4-aminophenyl)butanal has a molecular weight of 163.22 g/mol, XLogP of 1.96, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-aminophenyl)butanal is sourced from PubChem (CID 143206837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).