C17H26O — CID 117368882
2-[4-(3,3-dimethylcyclohexyl)phenyl]propan-1-ol (PubChem CID 117368882) has the molecular formula C17H26O and a molecular weight of 246.39 g/mol. Its IUPAC name is 2-[4-(3,3-dimethylcyclohexyl)phenyl]propan-1-ol.
| Compound Name | 2-[4-(3,3-dimethylcyclohexyl)phenyl]propan-1-ol |
|---|---|
| PubChem CID | 117368882 |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | 2-[4-(3,3-dimethylcyclohexyl)phenyl]propan-1-ol |
| SMILES | CC(CO)c1ccc(C2CCCC(C)(C)C2)cc1 |
| InChI | InChI=1S/C17H26O/c1-13(12-18)14-6-8-15(9-7-14)16-5-4-10-17(2,3)11-16/h6-9,13,16,18H,4-5,10-12H2,1-3H3 |
| InChIKey | YNKMMTIXMCJSKV-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |