C16H25NO — CID 117372106
2-amino-1-[3-(3,3-dimethylcyclohexyl)phenyl]ethanol (PubChem CID 117372106) has the molecular formula C16H25NO and a molecular weight of 247.38 g/mol. Its IUPAC name is 2-amino-1-[3-(3,3-dimethylcyclohexyl)phenyl]ethanol.
| Compound Name | 2-amino-1-[3-(3,3-dimethylcyclohexyl)phenyl]ethanol |
|---|---|
| PubChem CID | 117372106 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | 2-amino-1-[3-(3,3-dimethylcyclohexyl)phenyl]ethanol |
| SMILES | CC1(C)CCCC(c2cccc(C(O)CN)c2)C1 |
| InChI | InChI=1S/C16H25NO/c1-16(2)8-4-7-14(10-16)12-5-3-6-13(9-12)15(18)11-17/h3,5-6,9,14-15,18H,4,7-8,10-11,17H2,1-2H3 |
| InChIKey | NEBUBEIWQXQZBY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |