C17H25NO — CID 117402794
1-[3-(3,3-dimethylcyclohexyl)phenyl]-2-(methylamino)ethanone (PubChem CID 117402794) has the molecular formula C17H25NO and a molecular weight of 259.39 g/mol. Its IUPAC name is 1-[3-(3,3-dimethylcyclohexyl)phenyl]-2-(methylamino)ethanone.
| Compound Name | 1-[3-(3,3-dimethylcyclohexyl)phenyl]-2-(methylamino)ethanone |
|---|---|
| PubChem CID | 117402794 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | 1-[3-(3,3-dimethylcyclohexyl)phenyl]-2-(methylamino)ethanone |
| SMILES | CNCC(=O)c1cccc(C2CCCC(C)(C)C2)c1 |
| InChI | InChI=1S/C17H25NO/c1-17(2)9-5-8-15(11-17)13-6-4-7-14(10-13)16(19)12-18-3/h4,6-7,10,15,18H,5,8-9,11-12H2,1-3H3 |
| InChIKey | ZZXCJQLVQFEARX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |