C19H29N — CID 117431724
1-[1-[3-(3,3-dimethylcyclohexyl)phenyl]cyclopropyl]ethanamine (PubChem CID 117431724) has the molecular formula C19H29N and a molecular weight of 271.45 g/mol. Its IUPAC name is 1-[1-[3-(3,3-dimethylcyclohexyl)phenyl]cyclopropyl]ethanamine.
| Compound Name | 1-[1-[3-(3,3-dimethylcyclohexyl)phenyl]cyclopropyl]ethanamine |
|---|---|
| PubChem CID | 117431724 |
| Molecular Formula | C19H29N |
| Molecular Weight | 271.45 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | 1-[1-[3-(3,3-dimethylcyclohexyl)phenyl]cyclopropyl]ethanamine |
| SMILES | CC(N)C1(c2cccc(C3CCCC(C)(C)C3)c2)CC1 |
| InChI | InChI=1S/C19H29N/c1-14(20)19(10-11-19)17-8-4-6-15(12-17)16-7-5-9-18(2,3)13-16/h4,6,8,12,14,16H,5,7,9-11,13,20H2,1-3H3 |
| InChIKey | HHSNDARNYVILQC-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.45 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |