C10H14N2O2 — CID 121250381
1,1-diisocyanato-2,4-dimethylcyclohexane (PubChem CID 121250381) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is 1,1-diisocyanato-2,4-dimethylcyclohexane.
| Compound Name | 1,1-diisocyanato-2,4-dimethylcyclohexane |
|---|---|
| PubChem CID | 121250381 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 1,1-diisocyanato-2,4-dimethylcyclohexane |
| SMILES | CC1CCC(N=C=O)(N=C=O)C(C)C1 |
| InChI | InChI=1S/C10H14N2O2/c1-8-3-4-10(11-6-13,12-7-14)9(2)5-8/h8-9H,3-5H2,1-2H3 |
| InChIKey | LFOSJUKEHOYYLD-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|