C10H19NOS — CID 14715133
[(3R,4R)-4-amino-1-thiaspiro[4.5]decan-3-yl]methanol (PubChem CID 14715133) has the molecular formula C10H19NOS and a molecular weight of 201.33 g/mol. Its IUPAC name is [(3R,4R)-4-amino-1-thiaspiro[4.5]decan-3-yl]methanol.
| Compound Name | [(3R,4R)-4-amino-1-thiaspiro[4.5]decan-3-yl]methanol |
|---|---|
| PubChem CID | 14715133 |
| Molecular Formula | C10H19NOS |
| Molecular Weight | 201.33 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | [(3R,4R)-4-amino-1-thiaspiro[4.5]decan-3-yl]methanol |
| SMILES | N[C@@H]1[C@H](CO)CSC12CCCCC2 |
| InChI | InChI=1S/C10H19NOS/c11-9-8(6-12)7-13-10(9)4-2-1-3-5-10/h8-9,12H,1-7,11H2/t8-,9-/m1/s1 |
| InChIKey | NXMKSDZRYFTUEQ-RKDXNWHRSA-N |
| XLogP | 1.37 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.33 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |