C12H20O3S — CID 24740902
(3aR,7R,8aR)-spiro[3a,4,6,7,8,8a-hexahydrothiepino[3,4-d][1,3]dioxole-2,1'-cyclohexane]-7-ol (PubChem CID 24740902) has the molecular formula C12H20O3S and a molecular weight of 244.36 g/mol. Its IUPAC name is (3aR,7R,8aR)-spiro[3a,4,6,7,8,8a-hexahydrothiepino[3,4-d][1,3]dioxole-2,1'-cyclohexane]-7-ol.
| Compound Name | (3aR,7R,8aR)-spiro[3a,4,6,7,8,8a-hexahydrothiepino[3,4-d][1,3]dioxole-2,1'-cyclohexane]-7-ol |
|---|---|
| PubChem CID | 24740902 |
| Molecular Formula | C12H20O3S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | (3aR,7R,8aR)-spiro[3a,4,6,7,8,8a-hexahydrothiepino[3,4-d][1,3]dioxole-2,1'-cyclohexane]-7-ol |
| SMILES | O[C@H]1CSC[C@@H]2OC3(CCCCC3)O[C@@H]2C1 |
| InChI | InChI=1S/C12H20O3S/c13-9-6-10-11(8-16-7-9)15-12(14-10)4-2-1-3-5-12/h9-11,13H,1-8H2/t9-,10-,11+/m1/s1 |
| InChIKey | IHFAQBXADHNJDM-MXWKQRLJSA-N |
| XLogP | 1.93 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |