About (1S,4R)-1-oxodithiolan-4-ol
(1S,4R)-1-oxodithiolan-4-ol (PubChem CID 162950886) has the molecular formula C3H6O2S2
and a molecular weight of 138.21 g/mol. Its IUPAC name is (1S,4R)-1-oxodithiolan-4-ol.
Molecular Properties
| Compound Name | (1S,4R)-1-oxodithiolan-4-ol |
| PubChem CID | 162950886 |
| Molecular Formula | C3H6O2S2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 137.98 |
| IUPAC Name | (1S,4R)-1-oxodithiolan-4-ol |
| SMILES | O=[S@@]1C[C@H](O)CS1 |
| InChI | InChI=1S/C3H6O2S2/c4-3-1-6-7(5)2-3/h3-4H,1-2H2/t3-,7+/m1/s1 |
| InChIKey | MVXFWIGJTYCCIF-NFNCENRGSA-N |
| XLogP | -0.24 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze (1S,4R)-1-oxodithiolan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,4R)-1-oxodithiolan-4-ol?
The IUPAC name of (1S,4R)-1-oxodithiolan-4-ol (CID 162950886) is (1S,4R)-1-oxodithiolan-4-ol.
What is the SMILES notation for (1S,4R)-1-oxodithiolan-4-ol?
The canonical SMILES for (1S,4R)-1-oxodithiolan-4-ol is O=[S@@]1C[C@H](O)CS1.
What is the InChIKey of (1S,4R)-1-oxodithiolan-4-ol?
The InChIKey is MVXFWIGJTYCCIF-NFNCENRGSA-N. The full InChI is InChI=1S/C3H6O2S2/c4-3-1-6-7(5)2-3/h3-4H,1-2H2/t3-,7+/m1/s1.
What are the key properties of (1S,4R)-1-oxodithiolan-4-ol?
(1S,4R)-1-oxodithiolan-4-ol has a molecular weight of 138.21 g/mol, XLogP of -0.24, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,4R)-1-oxodithiolan-4-ol is sourced from PubChem (CID 162950886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).