C3H8N2O2S — CID 134182855
1-oxo-1,2,6-thiadiazinan-4-ol (PubChem CID 134182855) has the molecular formula C3H8N2O2S and a molecular weight of 136.18 g/mol. Its IUPAC name is 1-oxo-1,2,6-thiadiazinan-4-ol.
| Compound Name | 1-oxo-1,2,6-thiadiazinan-4-ol |
|---|---|
| PubChem CID | 134182855 |
| Molecular Formula | C3H8N2O2S |
| Molecular Weight | 136.18 g/mol |
| Exact Mass | 136.03 |
| IUPAC Name | 1-oxo-1,2,6-thiadiazinan-4-ol |
| SMILES | O=S1NCC(O)CN1 |
| InChI | InChI=1S/C3H8N2O2S/c6-3-1-4-8(7)5-2-3/h3-6H,1-2H2 |
| InChIKey | UHLTTWFBIPQTJE-UHFFFAOYSA-N |
| XLogP | -1.88 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.18 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |