C6H12N2O3 — CID 174231588
[(3R,5S)-5-hydroxypiperidin-3-yl]carbamic acid (PubChem CID 174231588) has the molecular formula C6H12N2O3 and a molecular weight of 160.17 g/mol. Its IUPAC name is [(3R,5S)-5-hydroxypiperidin-3-yl]carbamic acid.
| Compound Name | [(3R,5S)-5-hydroxypiperidin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 174231588 |
| Molecular Formula | C6H12N2O3 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.08 |
| IUPAC Name | [(3R,5S)-5-hydroxypiperidin-3-yl]carbamic acid |
| SMILES | O=C(O)N[C@H]1CNC[C@@H](O)C1 |
| InChI | InChI=1S/C6H12N2O3/c9-5-1-4(2-7-3-5)8-6(10)11/h4-5,7-9H,1-3H2,(H,10,11)/t4-,5+/m1/s1 |
| InChIKey | OYBBPLQQJLIZGF-UHNVWZDZSA-N |
| XLogP | -1.02 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |