[(3R,5S)-5-hydroxypiperidin-3-yl]carbamic acid

C6H12N2O3 — CID 174231588

IUPAC[(3R,5S)-5-hydroxypiperidin-3-yl]carbamic acid
SMILESO=C(O)N[C@H]1CNC[C@@H](O)C1
InChIInChI=1S/C6H12N2O3/c9-5-1-4(2-7-3-5)8-6(10)11/h4-5,7-9H,1-3H2,(H,10,11)/t4-,5+/m1/s1
InChIKeyOYBBPLQQJLIZGF-UHNVWZDZSA-N
MW160.17 g/mol
LogP-1.02
Rot. Bonds1

About [(3R,5S)-5-hydroxypiperidin-3-yl]carbamic acid

[(3R,5S)-5-hydroxypiperidin-3-yl]carbamic acid (PubChem CID 174231588) has the molecular formula C6H12N2O3 and a molecular weight of 160.17 g/mol. Its IUPAC name is [(3R,5S)-5-hydroxypiperidin-3-yl]carbamic acid.

Molecular Properties

Compound Name[(3R,5S)-5-hydroxypiperidin-3-yl]carbamic acid
PubChem CID174231588
Molecular FormulaC6H12N2O3
Molecular Weight160.17 g/mol
Exact Mass160.08
IUPAC Name[(3R,5S)-5-hydroxypiperidin-3-yl]carbamic acid
SMILESO=C(O)N[C@H]1CNC[C@@H](O)C1
InChIInChI=1S/C6H12N2O3/c9-5-1-4(2-7-3-5)8-6(10)11/h4-5,7-9H,1-3H2,(H,10,11)/t4-,5+/m1/s1
InChIKeyOYBBPLQQJLIZGF-UHNVWZDZSA-N
XLogP-1.02
TPSA81.59 Ų
H-Bond Donors4
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500160.17
LogP ≤ 5-1.02
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 103

Analyze [(3R,5S)-5-hydroxypiperidin-3-yl]carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [(3R,5S)-5-hydroxypiperidin-3-yl]carbamic acid?
The IUPAC name of [(3R,5S)-5-hydroxypiperidin-3-yl]carbamic acid (CID 174231588) is [(3R,5S)-5-hydroxypiperidin-3-yl]carbamic acid.
What is the SMILES notation for [(3R,5S)-5-hydroxypiperidin-3-yl]carbamic acid?
The canonical SMILES for [(3R,5S)-5-hydroxypiperidin-3-yl]carbamic acid is O=C(O)N[C@H]1CNC[C@@H](O)C1.
What is the InChIKey of [(3R,5S)-5-hydroxypiperidin-3-yl]carbamic acid?
The InChIKey is OYBBPLQQJLIZGF-UHNVWZDZSA-N. The full InChI is InChI=1S/C6H12N2O3/c9-5-1-4(2-7-3-5)8-6(10)11/h4-5,7-9H,1-3H2,(H,10,11)/t4-,5+/m1/s1.
What are the key properties of [(3R,5S)-5-hydroxypiperidin-3-yl]carbamic acid?
[(3R,5S)-5-hydroxypiperidin-3-yl]carbamic acid has a molecular weight of 160.17 g/mol, XLogP of -1.02, 1 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,5S)-5-hydroxypiperidin-3-yl]carbamic acid is sourced from PubChem (CID 174231588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).