C27H54N8O3 — CID 169229353
1,4,8,11,14,18,23,27-octazapentacyclo[9.9.9.24,8.214,18.223,27]pentatriacontane-6,16,25-triol (PubChem CID 169229353) has the molecular formula C27H54N8O3 and a molecular weight of 538.78 g/mol. Its IUPAC name is 1,4,8,11,14,18,23,27-octazapentacyclo[9.9.9.24,8.214,18.223,27]pentatriacontane-6,16,25-triol.
| Compound Name | 1,4,8,11,14,18,23,27-octazapentacyclo[9.9.9.24,8.214,18.223,27]pentatriacontane-6,16,25-triol |
|---|---|
| PubChem CID | 169229353 |
| Molecular Formula | C27H54N8O3 |
| Molecular Weight | 538.78 g/mol |
| Exact Mass | 538.43 |
| IUPAC Name | 1,4,8,11,14,18,23,27-octazapentacyclo[9.9.9.24,8.214,18.223,27]pentatriacontane-6,16,25-triol |
| SMILES | OC1CN2CCN3CCN4CCN(CCN(CCN(CC2)C1)CCN1CCN(CC3)CC(O)C1)CC(O)C4 |
| InChI | InChI=1S/C27H54N8O3/c36-25-19-30-7-1-28-2-8-31-15-17-34(23-26(37)21-31)11-5-29(4-10-33(20-25)14-13-30)6-12-35-18-16-32(9-3-28)22-27(38)24-35/h25-27,36-38H,1-24H2 |
| InChIKey | FOWLPPSYQLHFGC-UHFFFAOYSA-N |
| XLogP | -3.45 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.78 |
| LogP ≤ 5 | -3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |