C8H16N2O — CID 126580611
1,5-diazabicyclo[3.2.2]nonan-3-ylmethanol (PubChem CID 126580611) has the molecular formula C8H16N2O and a molecular weight of 156.23 g/mol. Its IUPAC name is 1,5-diazabicyclo[3.2.2]nonan-3-ylmethanol.
| Compound Name | 1,5-diazabicyclo[3.2.2]nonan-3-ylmethanol |
|---|---|
| PubChem CID | 126580611 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | 1,5-diazabicyclo[3.2.2]nonan-3-ylmethanol |
| SMILES | OCC1CN2CCN(CC2)C1 |
| InChI | InChI=1S/C8H16N2O/c11-7-8-5-9-1-2-10(6-8)4-3-9/h8,11H,1-7H2 |
| InChIKey | MCYHFPMIRBHIMX-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |