C7H16N2O — CID 92669953
[(6S)-1-methyl-1,4-diazepan-6-yl]methanol (PubChem CID 92669953) has the molecular formula C7H16N2O and a molecular weight of 144.22 g/mol. Its IUPAC name is [(6S)-1-methyl-1,4-diazepan-6-yl]methanol.
| Compound Name | [(6S)-1-methyl-1,4-diazepan-6-yl]methanol |
|---|---|
| PubChem CID | 92669953 |
| Molecular Formula | C7H16N2O |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.13 |
| IUPAC Name | [(6S)-1-methyl-1,4-diazepan-6-yl]methanol |
| SMILES | CN1CCNC[C@H](CO)C1 |
| InChI | InChI=1S/C7H16N2O/c1-9-3-2-8-4-7(5-9)6-10/h7-8,10H,2-6H2,1H3/t7-/m0/s1 |
| InChIKey | CUIRRVACBQLGDI-ZETCQYMHSA-N |
| XLogP | -0.87 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |