C13H20N2O — CID 86314075
[(6S)-1-benzyl-1,4-diazepan-6-yl]methanol (PubChem CID 86314075) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is [(6S)-1-benzyl-1,4-diazepan-6-yl]methanol.
| Compound Name | [(6S)-1-benzyl-1,4-diazepan-6-yl]methanol |
|---|---|
| PubChem CID | 86314075 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | [(6S)-1-benzyl-1,4-diazepan-6-yl]methanol |
| SMILES | OC[C@H]1CNCCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C13H20N2O/c16-11-13-8-14-6-7-15(10-13)9-12-4-2-1-3-5-12/h1-5,13-14,16H,6-11H2/t13-/m0/s1 |
| InChIKey | BQYVRHDXBKLRFX-ZDUSSCGKSA-N |
| XLogP | 0.70 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |