About [(6S)-1-benzyl-1,4-diazepan-6-yl]methanol
[(6S)-1-benzyl-1,4-diazepan-6-yl]methanol (PubChem CID 86314075) has the molecular formula C13H20N2O
and a molecular weight of 220.32 g/mol. Its IUPAC name is [(6S)-1-benzyl-1,4-diazepan-6-yl]methanol.
Molecular Properties
| Compound Name | [(6S)-1-benzyl-1,4-diazepan-6-yl]methanol |
| PubChem CID | 86314075 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | [(6S)-1-benzyl-1,4-diazepan-6-yl]methanol |
| SMILES | OC[C@H]1CNCCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C13H20N2O/c16-11-13-8-14-6-7-15(10-13)9-12-4-2-1-3-5-12/h1-5,13-14,16H,6-11H2/t13-/m0/s1 |
| InChIKey | BQYVRHDXBKLRFX-ZDUSSCGKSA-N |
| XLogP | 0.70 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(6S)-1-benzyl-1,4-diazepan-6-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(6S)-1-benzyl-1,4-diazepan-6-yl]methanol?
The IUPAC name of [(6S)-1-benzyl-1,4-diazepan-6-yl]methanol (CID 86314075) is [(6S)-1-benzyl-1,4-diazepan-6-yl]methanol.
What is the SMILES notation for [(6S)-1-benzyl-1,4-diazepan-6-yl]methanol?
The canonical SMILES for [(6S)-1-benzyl-1,4-diazepan-6-yl]methanol is OC[C@H]1CNCCN(Cc2ccccc2)C1.
What is the InChIKey of [(6S)-1-benzyl-1,4-diazepan-6-yl]methanol?
The InChIKey is BQYVRHDXBKLRFX-ZDUSSCGKSA-N. The full InChI is InChI=1S/C13H20N2O/c16-11-13-8-14-6-7-15(10-13)9-12-4-2-1-3-5-12/h1-5,13-14,16H,6-11H2/t13-/m0/s1.
What are the key properties of [(6S)-1-benzyl-1,4-diazepan-6-yl]methanol?
[(6S)-1-benzyl-1,4-diazepan-6-yl]methanol has a molecular weight of 220.32 g/mol, XLogP of 0.70, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(6S)-1-benzyl-1,4-diazepan-6-yl]methanol is sourced from PubChem (CID 86314075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).