C6H12OS — CID 124500554
(3S,6R)-6-methylthian-3-ol (PubChem CID 124500554) has the molecular formula C6H12OS and a molecular weight of 132.23 g/mol. Its IUPAC name is (3S,6R)-6-methylthian-3-ol.
| Compound Name | (3S,6R)-6-methylthian-3-ol |
|---|---|
| PubChem CID | 124500554 |
| Molecular Formula | C6H12OS |
| Molecular Weight | 132.23 g/mol |
| Exact Mass | 132.06 |
| IUPAC Name | (3S,6R)-6-methylthian-3-ol |
| SMILES | C[C@@H]1CC[C@H](O)CS1 |
| InChI | InChI=1S/C6H12OS/c1-5-2-3-6(7)4-8-5/h5-7H,2-4H2,1H3/t5-,6+/m1/s1 |
| InChIKey | WGYQFKTWCXEETG-RITPCOANSA-N |
| XLogP | 1.26 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.23 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |