C7H14S — CID 71394536
(2S,5S)-2,5-dimethylthiane (PubChem CID 71394536) has the molecular formula C7H14S and a molecular weight of 130.26 g/mol. Its IUPAC name is (2S,5S)-2,5-dimethylthiane.
| Compound Name | (2S,5S)-2,5-dimethylthiane |
|---|---|
| PubChem CID | 71394536 |
| Molecular Formula | C7H14S |
| Molecular Weight | 130.26 g/mol |
| Exact Mass | 130.08 |
| IUPAC Name | (2S,5S)-2,5-dimethylthiane |
| SMILES | C[C@H]1CC[C@H](C)SC1 |
| InChI | InChI=1S/C7H14S/c1-6-3-4-7(2)8-5-6/h6-7H,3-5H2,1-2H3/t6-,7-/m0/s1 |
| InChIKey | FCFFROVETURYHE-BQBZGAKWSA-N |
| XLogP | 2.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.26 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |