About 3,7-dimethyl-1,4-thiazepane
3,7-dimethyl-1,4-thiazepane (PubChem CID 66226495) has the molecular formula C7H15NS
and a molecular weight of 145.27 g/mol. Its IUPAC name is 3,7-dimethyl-1,4-thiazepane.
Molecular Properties
| Compound Name | 3,7-dimethyl-1,4-thiazepane |
| PubChem CID | 66226495 |
| Molecular Formula | C7H15NS |
| Molecular Weight | 145.27 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | 3,7-dimethyl-1,4-thiazepane |
| SMILES | CC1CSC(C)CCN1 |
| InChI | InChI=1S/C7H15NS/c1-6-5-9-7(2)3-4-8-6/h6-8H,3-5H2,1-2H3 |
| InChIKey | ZKFRPGGCZKDRPF-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.27 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,7-dimethyl-1,4-thiazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-dimethyl-1,4-thiazepane?
The IUPAC name of 3,7-dimethyl-1,4-thiazepane (CID 66226495) is 3,7-dimethyl-1,4-thiazepane.
What is the SMILES notation for 3,7-dimethyl-1,4-thiazepane?
The canonical SMILES for 3,7-dimethyl-1,4-thiazepane is CC1CSC(C)CCN1.
What is the InChIKey of 3,7-dimethyl-1,4-thiazepane?
The InChIKey is ZKFRPGGCZKDRPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NS/c1-6-5-9-7(2)3-4-8-6/h6-8H,3-5H2,1-2H3.
What are the key properties of 3,7-dimethyl-1,4-thiazepane?
3,7-dimethyl-1,4-thiazepane has a molecular weight of 145.27 g/mol, XLogP of 1.49, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dimethyl-1,4-thiazepane is sourced from PubChem (CID 66226495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).