About 5-bromo-2-methylthiane
5-bromo-2-methylthiane (PubChem CID 119030332) has the molecular formula C6H11BrS
and a molecular weight of 195.12 g/mol. Its IUPAC name is 5-bromo-2-methylthiane.
Molecular Properties
| Compound Name | 5-bromo-2-methylthiane |
| PubChem CID | 119030332 |
| Molecular Formula | C6H11BrS |
| Molecular Weight | 195.12 g/mol |
| Exact Mass | 193.98 |
| IUPAC Name | 5-bromo-2-methylthiane |
| SMILES | CC1CCC(Br)CS1 |
| InChI | InChI=1S/C6H11BrS/c1-5-2-3-6(7)4-8-5/h5-6H,2-4H2,1H3 |
| InChIKey | XAEMUMMYNRRPPE-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.12 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-2-methylthiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-methylthiane?
The IUPAC name of 5-bromo-2-methylthiane (CID 119030332) is 5-bromo-2-methylthiane.
What is the SMILES notation for 5-bromo-2-methylthiane?
The canonical SMILES for 5-bromo-2-methylthiane is CC1CCC(Br)CS1.
What is the InChIKey of 5-bromo-2-methylthiane?
The InChIKey is XAEMUMMYNRRPPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11BrS/c1-5-2-3-6(7)4-8-5/h5-6H,2-4H2,1H3.
What are the key properties of 5-bromo-2-methylthiane?
5-bromo-2-methylthiane has a molecular weight of 195.12 g/mol, XLogP of 2.67, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-methylthiane is sourced from PubChem (CID 119030332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).