C7H13BrS2 — CID 20706972
5-bromo-2,4,6-trimethyl-1,3-dithiane (PubChem CID 20706972) has the molecular formula C7H13BrS2 and a molecular weight of 241.22 g/mol. Its IUPAC name is 5-bromo-2,4,6-trimethyl-1,3-dithiane.
| Compound Name | 5-bromo-2,4,6-trimethyl-1,3-dithiane |
|---|---|
| PubChem CID | 20706972 |
| Molecular Formula | C7H13BrS2 |
| Molecular Weight | 241.22 g/mol |
| Exact Mass | 239.96 |
| IUPAC Name | 5-bromo-2,4,6-trimethyl-1,3-dithiane |
| SMILES | CC1SC(C)C(Br)C(C)S1 |
| InChI | InChI=1S/C7H13BrS2/c1-4-7(8)5(2)10-6(3)9-4/h4-7H,1-3H3 |
| InChIKey | WHNKHCJRCNMWCK-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.22 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|