About 2-[(2S)-1-bromopropan-2-yl]-1,3-dithiane
2-[(2S)-1-bromopropan-2-yl]-1,3-dithiane (PubChem CID 11207207) has the molecular formula C7H13BrS2
and a molecular weight of 241.22 g/mol. Its IUPAC name is 2-[(2S)-1-bromopropan-2-yl]-1,3-dithiane.
Molecular Properties
| Compound Name | 2-[(2S)-1-bromopropan-2-yl]-1,3-dithiane |
| PubChem CID | 11207207 |
| Molecular Formula | C7H13BrS2 |
| Molecular Weight | 241.22 g/mol |
| Exact Mass | 239.96 |
| IUPAC Name | 2-[(2S)-1-bromopropan-2-yl]-1,3-dithiane |
| SMILES | C[C@H](CBr)C1SCCCS1 |
| InChI | InChI=1S/C7H13BrS2/c1-6(5-8)7-9-3-2-4-10-7/h6-7H,2-5H2,1H3/t6-/m1/s1 |
| InChIKey | VCDGVIHVNPCRBB-ZCFIWIBFSA-N |
| XLogP | 3.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.22 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2S)-1-bromopropan-2-yl]-1,3-dithiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2S)-1-bromopropan-2-yl]-1,3-dithiane?
The IUPAC name of 2-[(2S)-1-bromopropan-2-yl]-1,3-dithiane (CID 11207207) is 2-[(2S)-1-bromopropan-2-yl]-1,3-dithiane.
What is the SMILES notation for 2-[(2S)-1-bromopropan-2-yl]-1,3-dithiane?
The canonical SMILES for 2-[(2S)-1-bromopropan-2-yl]-1,3-dithiane is C[C@H](CBr)C1SCCCS1.
What is the InChIKey of 2-[(2S)-1-bromopropan-2-yl]-1,3-dithiane?
The InChIKey is VCDGVIHVNPCRBB-ZCFIWIBFSA-N. The full InChI is InChI=1S/C7H13BrS2/c1-6(5-8)7-9-3-2-4-10-7/h6-7H,2-5H2,1H3/t6-/m1/s1.
What are the key properties of 2-[(2S)-1-bromopropan-2-yl]-1,3-dithiane?
2-[(2S)-1-bromopropan-2-yl]-1,3-dithiane has a molecular weight of 241.22 g/mol, XLogP of 3.21, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2S)-1-bromopropan-2-yl]-1,3-dithiane is sourced from PubChem (CID 11207207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).