About 2-(4-bromopentyl)-1,3-dithiane
2-(4-bromopentyl)-1,3-dithiane (PubChem CID 15751235) has the molecular formula C9H17BrS2
and a molecular weight of 269.27 g/mol. Its IUPAC name is 2-(4-bromopentyl)-1,3-dithiane.
Molecular Properties
| Compound Name | 2-(4-bromopentyl)-1,3-dithiane |
| PubChem CID | 15751235 |
| Molecular Formula | C9H17BrS2 |
| Molecular Weight | 269.27 g/mol |
| Exact Mass | 268.00 |
| IUPAC Name | 2-(4-bromopentyl)-1,3-dithiane |
| SMILES | CC(Br)CCCC1SCCCS1 |
| InChI | InChI=1S/C9H17BrS2/c1-8(10)4-2-5-9-11-6-3-7-12-9/h8-9H,2-7H2,1H3 |
| InChIKey | UMRYOHLYOHWHPR-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.27 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-bromopentyl)-1,3-dithiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromopentyl)-1,3-dithiane?
The IUPAC name of 2-(4-bromopentyl)-1,3-dithiane (CID 15751235) is 2-(4-bromopentyl)-1,3-dithiane.
What is the SMILES notation for 2-(4-bromopentyl)-1,3-dithiane?
The canonical SMILES for 2-(4-bromopentyl)-1,3-dithiane is CC(Br)CCCC1SCCCS1.
What is the InChIKey of 2-(4-bromopentyl)-1,3-dithiane?
The InChIKey is UMRYOHLYOHWHPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17BrS2/c1-8(10)4-2-5-9-11-6-3-7-12-9/h8-9H,2-7H2,1H3.
What are the key properties of 2-(4-bromopentyl)-1,3-dithiane?
2-(4-bromopentyl)-1,3-dithiane has a molecular weight of 269.27 g/mol, XLogP of 4.14, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromopentyl)-1,3-dithiane is sourced from PubChem (CID 15751235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).