About 1,4-dioxane;2-(2-hydroxypropoxy)propan-1-ol
1,4-dioxane;2-(2-hydroxypropoxy)propan-1-ol (PubChem CID 160854185) has the molecular formula C10H22O5
and a molecular weight of 222.28 g/mol. Its IUPAC name is 1,4-dioxane;2-(2-hydroxypropoxy)propan-1-ol.
Molecular Properties
| Compound Name | 1,4-dioxane;2-(2-hydroxypropoxy)propan-1-ol |
| PubChem CID | 160854185 |
| Molecular Formula | C10H22O5 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | 1,4-dioxane;2-(2-hydroxypropoxy)propan-1-ol |
| SMILES | C1COCCO1.CC(O)COC(C)CO |
| InChI | InChI=1S/C6H14O3.C4H8O2/c1-5(8)4-9-6(2)3-7;1-2-6-4-3-5-1/h5-8H,3-4H2,1-2H3;1-4H2 |
| InChIKey | SJQPHJWTJAMYNV-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,4-dioxane;2-(2-hydroxypropoxy)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dioxane;2-(2-hydroxypropoxy)propan-1-ol?
The IUPAC name of 1,4-dioxane;2-(2-hydroxypropoxy)propan-1-ol (CID 160854185) is 1,4-dioxane;2-(2-hydroxypropoxy)propan-1-ol.
What is the SMILES notation for 1,4-dioxane;2-(2-hydroxypropoxy)propan-1-ol?
The canonical SMILES for 1,4-dioxane;2-(2-hydroxypropoxy)propan-1-ol is C1COCCO1.CC(O)COC(C)CO.
What is the InChIKey of 1,4-dioxane;2-(2-hydroxypropoxy)propan-1-ol?
The InChIKey is SJQPHJWTJAMYNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O3.C4H8O2/c1-5(8)4-9-6(2)3-7;1-2-6-4-3-5-1/h5-8H,3-4H2,1-2H3;1-4H2.
What are the key properties of 1,4-dioxane;2-(2-hydroxypropoxy)propan-1-ol?
1,4-dioxane;2-(2-hydroxypropoxy)propan-1-ol has a molecular weight of 222.28 g/mol, XLogP of -0.20, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dioxane;2-(2-hydroxypropoxy)propan-1-ol is sourced from PubChem (CID 160854185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).