About oxirane;propane;propane-1,2-diol
oxirane;propane;propane-1,2-diol (PubChem CID 174282162) has the molecular formula C8H20O3
and a molecular weight of 164.24 g/mol. Its IUPAC name is oxirane;propane;propane-1,2-diol.
Molecular Properties
| Compound Name | oxirane;propane;propane-1,2-diol |
| PubChem CID | 174282162 |
| Molecular Formula | C8H20O3 |
| Molecular Weight | 164.24 g/mol |
| Exact Mass | 164.14 |
| IUPAC Name | oxirane;propane;propane-1,2-diol |
| SMILES | C1CO1.CC(O)CO.CCC |
| InChI | InChI=1S/C3H8O2.C3H8.C2H4O/c1-3(5)2-4;1-3-2;1-2-3-1/h3-5H,2H2,1H3;3H2,1-2H3;1-2H2 |
| InChIKey | RGQISIZATSTRLN-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.24 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze oxirane;propane;propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxirane;propane;propane-1,2-diol?
The IUPAC name of oxirane;propane;propane-1,2-diol (CID 174282162) is oxirane;propane;propane-1,2-diol.
What is the SMILES notation for oxirane;propane;propane-1,2-diol?
The canonical SMILES for oxirane;propane;propane-1,2-diol is C1CO1.CC(O)CO.CCC.
What is the InChIKey of oxirane;propane;propane-1,2-diol?
The InChIKey is RGQISIZATSTRLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O2.C3H8.C2H4O/c1-3(5)2-4;1-3-2;1-2-3-1/h3-5H,2H2,1H3;3H2,1-2H3;1-2H2.
What are the key properties of oxirane;propane;propane-1,2-diol?
oxirane;propane;propane-1,2-diol has a molecular weight of 164.24 g/mol, XLogP of 0.79, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxirane;propane;propane-1,2-diol is sourced from PubChem (CID 174282162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).