C6H12O3 — CID 167523852
3-butan-2-yl-1,2,4-trioxolane (PubChem CID 167523852) has the molecular formula C6H12O3 and a molecular weight of 132.16 g/mol. Its IUPAC name is 3-butan-2-yl-1,2,4-trioxolane.
| Compound Name | 3-butan-2-yl-1,2,4-trioxolane |
|---|---|
| PubChem CID | 167523852 |
| Molecular Formula | C6H12O3 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.08 |
| IUPAC Name | 3-butan-2-yl-1,2,4-trioxolane |
| SMILES | CCC(C)C1OCOO1 |
| InChI | InChI=1S/C6H12O3/c1-3-5(2)6-7-4-8-9-6/h5-6H,3-4H2,1-2H3 |
| InChIKey | LUKHXVJHDDZFSN-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|