C8H14O3 — CID 90985845
1-(4,6-dimethyl-1,3-dioxan-5-yl)ethanone (PubChem CID 90985845) has the molecular formula C8H14O3 and a molecular weight of 158.20 g/mol. Its IUPAC name is 1-(4,6-dimethyl-1,3-dioxan-5-yl)ethanone.
| Compound Name | 1-(4,6-dimethyl-1,3-dioxan-5-yl)ethanone |
|---|---|
| PubChem CID | 90985845 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | 1-(4,6-dimethyl-1,3-dioxan-5-yl)ethanone |
| SMILES | CC(=O)C1C(C)OCOC1C |
| InChI | InChI=1S/C8H14O3/c1-5(9)8-6(2)10-4-11-7(8)3/h6-8H,4H2,1-3H3 |
| InChIKey | HFUQEOOGVZQZOL-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |