C14H22O3 — CID 144530795
1-[(3R)-2,4-diacetyl-3,5-dimethylcyclohexyl]ethanone (PubChem CID 144530795) has the molecular formula C14H22O3 and a molecular weight of 238.33 g/mol. Its IUPAC name is 1-[(3R)-2,4-diacetyl-3,5-dimethylcyclohexyl]ethanone.
| Compound Name | 1-[(3R)-2,4-diacetyl-3,5-dimethylcyclohexyl]ethanone |
|---|---|
| PubChem CID | 144530795 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | 1-[(3R)-2,4-diacetyl-3,5-dimethylcyclohexyl]ethanone |
| SMILES | CC(=O)C1CC(C)C(C(C)=O)[C@@H](C)C1C(C)=O |
| InChI | InChI=1S/C14H22O3/c1-7-6-12(9(3)15)14(11(5)17)8(2)13(7)10(4)16/h7-8,12-14H,6H2,1-5H3/t7?,8-,12?,13?,14?/m1/s1 |
| InChIKey | HZMKWMVEDWOVRJ-ZIWCIARVSA-N |
| XLogP | 2.28 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |