About ethane;1-[(2S)-3,6,6-trimethyl-2-bicyclo[3.1.0]hexanyl]ethanone
ethane;1-[(2S)-3,6,6-trimethyl-2-bicyclo[3.1.0]hexanyl]ethanone (PubChem CID 143360983) has the molecular formula C13H24O
and a molecular weight of 196.33 g/mol. Its IUPAC name is ethane;1-[(2S)-3,6,6-trimethyl-2-bicyclo[3.1.0]hexanyl]ethanone.
Molecular Properties
| Compound Name | ethane;1-[(2S)-3,6,6-trimethyl-2-bicyclo[3.1.0]hexanyl]ethanone |
| PubChem CID | 143360983 |
| Molecular Formula | C13H24O |
| Molecular Weight | 196.33 g/mol |
| Exact Mass | 196.18 |
| IUPAC Name | ethane;1-[(2S)-3,6,6-trimethyl-2-bicyclo[3.1.0]hexanyl]ethanone |
| SMILES | CC.CC(=O)[C@H]1C(C)CC2C1C2(C)C |
| InChI | InChI=1S/C11H18O.C2H6/c1-6-5-8-10(11(8,3)4)9(6)7(2)12;1-2/h6,8-10H,5H2,1-4H3;1-2H3/t6?,8?,9-,10?;/m1./s1 |
| InChIKey | BJQPYEBLGAULAH-RTMJSTJGSA-N |
| XLogP | 3.53 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.33 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;1-[(2S)-3,6,6-trimethyl-2-bicyclo[3.1.0]hexanyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-[(2S)-3,6,6-trimethyl-2-bicyclo[3.1.0]hexanyl]ethanone?
The IUPAC name of ethane;1-[(2S)-3,6,6-trimethyl-2-bicyclo[3.1.0]hexanyl]ethanone (CID 143360983) is ethane;1-[(2S)-3,6,6-trimethyl-2-bicyclo[3.1.0]hexanyl]ethanone.
What is the SMILES notation for ethane;1-[(2S)-3,6,6-trimethyl-2-bicyclo[3.1.0]hexanyl]ethanone?
The canonical SMILES for ethane;1-[(2S)-3,6,6-trimethyl-2-bicyclo[3.1.0]hexanyl]ethanone is CC.CC(=O)[C@H]1C(C)CC2C1C2(C)C.
What is the InChIKey of ethane;1-[(2S)-3,6,6-trimethyl-2-bicyclo[3.1.0]hexanyl]ethanone?
The InChIKey is BJQPYEBLGAULAH-RTMJSTJGSA-N. The full InChI is InChI=1S/C11H18O.C2H6/c1-6-5-8-10(11(8,3)4)9(6)7(2)12;1-2/h6,8-10H,5H2,1-4H3;1-2H3/t6?,8?,9-,10?;/m1./s1.
What are the key properties of ethane;1-[(2S)-3,6,6-trimethyl-2-bicyclo[3.1.0]hexanyl]ethanone?
ethane;1-[(2S)-3,6,6-trimethyl-2-bicyclo[3.1.0]hexanyl]ethanone has a molecular weight of 196.33 g/mol, XLogP of 3.53, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-[(2S)-3,6,6-trimethyl-2-bicyclo[3.1.0]hexanyl]ethanone is sourced from PubChem (CID 143360983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).