C10H14O4-2 — CID 21247464
2,5-dimethylcyclohexane-1,4-dicarboxylate (PubChem CID 21247464) has the molecular formula C10H14O4-2 and a molecular weight of 198.22 g/mol. Its IUPAC name is 2,5-dimethylcyclohexane-1,4-dicarboxylate.
| Compound Name | 2,5-dimethylcyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 21247464 |
| Molecular Formula | C10H14O4-2 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 2,5-dimethylcyclohexane-1,4-dicarboxylate |
| SMILES | CC1CC(C(=O)[O-])C(C)CC1C(=O)[O-] |
| InChI | InChI=1S/C10H16O4/c1-5-3-8(10(13)14)6(2)4-7(5)9(11)12/h5-8H,3-4H2,1-2H3,(H,11,12)(H,13,14)/p-2 |
| InChIKey | PFRKBPIIZRLSOS-UHFFFAOYSA-L |
| XLogP | -1.22 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |