C9H12NO3- — CID 18434341
2-[cyclopropyl(methyl)carbamoyl]cyclopropane-1-carboxylate (PubChem CID 18434341) has the molecular formula C9H12NO3- and a molecular weight of 182.20 g/mol. Its IUPAC name is 2-[cyclopropyl(methyl)carbamoyl]cyclopropane-1-carboxylate.
| Compound Name | 2-[cyclopropyl(methyl)carbamoyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 18434341 |
| Molecular Formula | C9H12NO3- |
| Molecular Weight | 182.20 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | 2-[cyclopropyl(methyl)carbamoyl]cyclopropane-1-carboxylate |
| SMILES | CN(C(=O)C1CC1C(=O)[O-])C1CC1 |
| InChI | InChI=1S/C9H13NO3/c1-10(5-2-3-5)8(11)6-4-7(6)9(12)13/h5-7H,2-4H2,1H3,(H,12,13)/p-1 |
| InChIKey | GTWKAFFWQLIDSD-UHFFFAOYSA-M |
| XLogP | -1.01 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.20 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |