C7H12O2 — CID 102014015
1-[(2S,3R)-2-methyloxolan-3-yl]ethanone (PubChem CID 102014015) has the molecular formula C7H12O2 and a molecular weight of 128.17 g/mol. Its IUPAC name is 1-[(2S,3R)-2-methyloxolan-3-yl]ethanone.
| Compound Name | 1-[(2S,3R)-2-methyloxolan-3-yl]ethanone |
|---|---|
| PubChem CID | 102014015 |
| Molecular Formula | C7H12O2 |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.08 |
| IUPAC Name | 1-[(2S,3R)-2-methyloxolan-3-yl]ethanone |
| SMILES | CC(=O)[C@@H]1CCO[C@H]1C |
| InChI | InChI=1S/C7H12O2/c1-5(8)7-3-4-9-6(7)2/h6-7H,3-4H2,1-2H3/t6-,7-/m0/s1 |
| InChIKey | AFLWQLKUHZFTQL-BQBZGAKWSA-N |
| XLogP | 1.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |