C7H14O3S — CID 162183479
acetic acid;(2S,3R)-2-methyloxolane-3-thiol (PubChem CID 162183479) has the molecular formula C7H14O3S and a molecular weight of 178.25 g/mol. Its IUPAC name is acetic acid;(2S,3R)-2-methyloxolane-3-thiol.
| Compound Name | acetic acid;(2S,3R)-2-methyloxolane-3-thiol |
|---|---|
| PubChem CID | 162183479 |
| Molecular Formula | C7H14O3S |
| Molecular Weight | 178.25 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | acetic acid;(2S,3R)-2-methyloxolane-3-thiol |
| SMILES | CC(=O)O.C[C@@H]1OCC[C@H]1S |
| InChI | InChI=1S/C5H10OS.C2H4O2/c1-4-5(7)2-3-6-4;1-2(3)4/h4-5,7H,2-3H2,1H3;1H3,(H,3,4)/t4-,5+;/m0./s1 |
| InChIKey | ZPIUNDKPHNUHLC-UYXJWNHNSA-N |
| XLogP | 1.18 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.25 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|