acetic acid;(2S,3R)-2-methyloxolane-3-thiol

C7H14O3S — CID 162183479

IUPACacetic acid;(2S,3R)-2-methyloxolane-3-thiol
SMILESCC(=O)O.C[C@@H]1OCC[C@H]1S
InChIInChI=1S/C5H10OS.C2H4O2/c1-4-5(7)2-3-6-4;1-2(3)4/h4-5,7H,2-3H2,1H3;1H3,(H,3,4)/t4-,5+;/m0./s1
InChIKeyZPIUNDKPHNUHLC-UYXJWNHNSA-N
MW178.25 g/mol
LogP1.18
Rot. Bonds

About acetic acid;(2S,3R)-2-methyloxolane-3-thiol

acetic acid;(2S,3R)-2-methyloxolane-3-thiol (PubChem CID 162183479) has the molecular formula C7H14O3S and a molecular weight of 178.25 g/mol. Its IUPAC name is acetic acid;(2S,3R)-2-methyloxolane-3-thiol.

Molecular Properties

Compound Nameacetic acid;(2S,3R)-2-methyloxolane-3-thiol
PubChem CID162183479
Molecular FormulaC7H14O3S
Molecular Weight178.25 g/mol
Exact Mass178.07
IUPAC Nameacetic acid;(2S,3R)-2-methyloxolane-3-thiol
SMILESCC(=O)O.C[C@@H]1OCC[C@H]1S
InChIInChI=1S/C5H10OS.C2H4O2/c1-4-5(7)2-3-6-4;1-2(3)4/h4-5,7H,2-3H2,1H3;1H3,(H,3,4)/t4-,5+;/m0./s1
InChIKeyZPIUNDKPHNUHLC-UYXJWNHNSA-N
XLogP1.18
TPSA46.53 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500178.25
LogP ≤ 51.18
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'thiol_2', 'substructure': 'N/A'}

Analyze acetic acid;(2S,3R)-2-methyloxolane-3-thiol with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;(2S,3R)-2-methyloxolane-3-thiol?
The IUPAC name of acetic acid;(2S,3R)-2-methyloxolane-3-thiol (CID 162183479) is acetic acid;(2S,3R)-2-methyloxolane-3-thiol.
What is the SMILES notation for acetic acid;(2S,3R)-2-methyloxolane-3-thiol?
The canonical SMILES for acetic acid;(2S,3R)-2-methyloxolane-3-thiol is CC(=O)O.C[C@@H]1OCC[C@H]1S.
What is the InChIKey of acetic acid;(2S,3R)-2-methyloxolane-3-thiol?
The InChIKey is ZPIUNDKPHNUHLC-UYXJWNHNSA-N. The full InChI is InChI=1S/C5H10OS.C2H4O2/c1-4-5(7)2-3-6-4;1-2(3)4/h4-5,7H,2-3H2,1H3;1H3,(H,3,4)/t4-,5+;/m0./s1.
What are the key properties of acetic acid;(2S,3R)-2-methyloxolane-3-thiol?
acetic acid;(2S,3R)-2-methyloxolane-3-thiol has a molecular weight of 178.25 g/mol, XLogP of 1.18, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;(2S,3R)-2-methyloxolane-3-thiol is sourced from PubChem (CID 162183479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).