C9H20NO2+ — CID 118723725
trimethyl-[[(2R,3S)-3-methyl-1,4-dioxan-2-yl]methyl]azanium (PubChem CID 118723725) has the molecular formula C9H20NO2+ and a molecular weight of 174.26 g/mol. Its IUPAC name is trimethyl-[[(2R,3S)-3-methyl-1,4-dioxan-2-yl]methyl]azanium.
| Compound Name | trimethyl-[[(2R,3S)-3-methyl-1,4-dioxan-2-yl]methyl]azanium |
|---|---|
| PubChem CID | 118723725 |
| Molecular Formula | C9H20NO2+ |
| Molecular Weight | 174.26 g/mol |
| Exact Mass | 174.15 |
| IUPAC Name | trimethyl-[[(2R,3S)-3-methyl-1,4-dioxan-2-yl]methyl]azanium |
| SMILES | C[C@@H]1OCCO[C@@H]1C[N+](C)(C)C |
| InChI | InChI=1S/C9H20NO2/c1-8-9(7-10(2,3)4)12-6-5-11-8/h8-9H,5-7H2,1-4H3/q+1/t8-,9+/m0/s1 |
| InChIKey | IIKBMJYNDICPJR-DTWKUNHWSA-N |
| XLogP | 0.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.26 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|