C6H10O3 — CID 119097855
2-(3-methyloxiran-2-yl)-1,3-dioxolane (PubChem CID 119097855) has the molecular formula C6H10O3 and a molecular weight of 130.14 g/mol. Its IUPAC name is 2-(3-methyloxiran-2-yl)-1,3-dioxolane.
| Compound Name | 2-(3-methyloxiran-2-yl)-1,3-dioxolane |
|---|---|
| PubChem CID | 119097855 |
| Molecular Formula | C6H10O3 |
| Molecular Weight | 130.14 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | 2-(3-methyloxiran-2-yl)-1,3-dioxolane |
| SMILES | CC1OC1C1OCCO1 |
| InChI | InChI=1S/C6H10O3/c1-4-5(9-4)6-7-2-3-8-6/h4-6H,2-3H2,1H3 |
| InChIKey | UQGGOSGDZRZGJO-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.14 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|