C8H14O5 — CID 142006895
8-methyl-1,5,7,9,12-pentaoxaspiro[5.6]dodecane (PubChem CID 142006895) has the molecular formula C8H14O5 and a molecular weight of 190.19 g/mol. Its IUPAC name is 8-methyl-1,5,7,9,12-pentaoxaspiro[5.6]dodecane.
| Compound Name | 8-methyl-1,5,7,9,12-pentaoxaspiro[5.6]dodecane |
|---|---|
| PubChem CID | 142006895 |
| Molecular Formula | C8H14O5 |
| Molecular Weight | 190.19 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | 8-methyl-1,5,7,9,12-pentaoxaspiro[5.6]dodecane |
| SMILES | CC1OCCOC2(OCCCO2)O1 |
| InChI | InChI=1S/C8H14O5/c1-7-9-5-6-12-8(13-7)10-3-2-4-11-8/h7H,2-6H2,1H3 |
| InChIKey | FSWACEBSNZCKCH-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.19 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |