C13H24O4 — CID 139775673
4a-heptyl-3,6,7,8a-tetrahydro-2H-[1,4]dioxino[2,3-b][1,4]dioxine (PubChem CID 139775673) has the molecular formula C13H24O4 and a molecular weight of 244.33 g/mol. Its IUPAC name is 4a-heptyl-3,6,7,8a-tetrahydro-2H-[1,4]dioxino[2,3-b][1,4]dioxine.
| Compound Name | 4a-heptyl-3,6,7,8a-tetrahydro-2H-[1,4]dioxino[2,3-b][1,4]dioxine |
|---|---|
| PubChem CID | 139775673 |
| Molecular Formula | C13H24O4 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | 4a-heptyl-3,6,7,8a-tetrahydro-2H-[1,4]dioxino[2,3-b][1,4]dioxine |
| SMILES | CCCCCCCC12OCCOC1OCCO2 |
| InChI | InChI=1S/C13H24O4/c1-2-3-4-5-6-7-13-12(14-8-10-16-13)15-9-11-17-13/h12H,2-11H2,1H3 |
| InChIKey | DACXAVHGLDOOIV-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|