C5H8Cl2O2 — CID 13155217
2,3-dichloro-2-methyl-1,4-dioxane (PubChem CID 13155217) has the molecular formula C5H8Cl2O2 and a molecular weight of 171.02 g/mol. Its IUPAC name is 2,3-dichloro-2-methyl-1,4-dioxane.
| Compound Name | 2,3-dichloro-2-methyl-1,4-dioxane |
|---|---|
| PubChem CID | 13155217 |
| Molecular Formula | C5H8Cl2O2 |
| Molecular Weight | 171.02 g/mol |
| Exact Mass | 169.99 |
| IUPAC Name | 2,3-dichloro-2-methyl-1,4-dioxane |
| SMILES | CC1(Cl)OCCOC1Cl |
| InChI | InChI=1S/C5H8Cl2O2/c1-5(7)4(6)8-2-3-9-5/h4H,2-3H2,1H3 |
| InChIKey | DXKNAQVDCPOSSF-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.02 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|