C9H13ClO2 — CID 57413279
(1'R,5'R)-6'-chloro-6'-methylspiro[1,3-dioxolane-2,2'-bicyclo[3.1.0]hexane] (PubChem CID 57413279) has the molecular formula C9H13ClO2 and a molecular weight of 188.65 g/mol. Its IUPAC name is (1'R,5'R)-6'-chloro-6'-methylspiro[1,3-dioxolane-2,2'-bicyclo[3.1.0]hexane].
| Compound Name | (1'R,5'R)-6'-chloro-6'-methylspiro[1,3-dioxolane-2,2'-bicyclo[3.1.0]hexane] |
|---|---|
| PubChem CID | 57413279 |
| Molecular Formula | C9H13ClO2 |
| Molecular Weight | 188.65 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | (1'R,5'R)-6'-chloro-6'-methylspiro[1,3-dioxolane-2,2'-bicyclo[3.1.0]hexane] |
| SMILES | CC1(Cl)[C@@H]2CCC3(OCCO3)[C@@H]21 |
| InChI | InChI=1S/C9H13ClO2/c1-8(10)6-2-3-9(7(6)8)11-4-5-12-9/h6-7H,2-5H2,1H3/t6-,7+,8?/m1/s1 |
| InChIKey | FBPDOQNHDXLFKU-KVARREAHSA-N |
| XLogP | 1.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.65 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|