About (3,3-dimethyl-1,4-dioxan-2-yl)methanethiol
(3,3-dimethyl-1,4-dioxan-2-yl)methanethiol (PubChem CID 154809652) has the molecular formula C7H14O2S
and a molecular weight of 162.25 g/mol. Its IUPAC name is (3,3-dimethyl-1,4-dioxan-2-yl)methanethiol.
Molecular Properties
| Compound Name | (3,3-dimethyl-1,4-dioxan-2-yl)methanethiol |
| PubChem CID | 154809652 |
| Molecular Formula | C7H14O2S |
| Molecular Weight | 162.25 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | (3,3-dimethyl-1,4-dioxan-2-yl)methanethiol |
| SMILES | CC1(C)OCCOC1CS |
| InChI | InChI=1S/C7H14O2S/c1-7(2)6(5-10)8-3-4-9-7/h6,10H,3-5H2,1-2H3 |
| InChIKey | ACTDPRCWKDLPNH-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.25 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (3,3-dimethyl-1,4-dioxan-2-yl)methanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,3-dimethyl-1,4-dioxan-2-yl)methanethiol?
The IUPAC name of (3,3-dimethyl-1,4-dioxan-2-yl)methanethiol (CID 154809652) is (3,3-dimethyl-1,4-dioxan-2-yl)methanethiol.
What is the SMILES notation for (3,3-dimethyl-1,4-dioxan-2-yl)methanethiol?
The canonical SMILES for (3,3-dimethyl-1,4-dioxan-2-yl)methanethiol is CC1(C)OCCOC1CS.
What is the InChIKey of (3,3-dimethyl-1,4-dioxan-2-yl)methanethiol?
The InChIKey is ACTDPRCWKDLPNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O2S/c1-7(2)6(5-10)8-3-4-9-7/h6,10H,3-5H2,1-2H3.
What are the key properties of (3,3-dimethyl-1,4-dioxan-2-yl)methanethiol?
(3,3-dimethyl-1,4-dioxan-2-yl)methanethiol has a molecular weight of 162.25 g/mol, XLogP of 1.11, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3,3-dimethyl-1,4-dioxan-2-yl)methanethiol is sourced from PubChem (CID 154809652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).