C7H12O3 — CID 54155497
4,7-dioxaspiro[2.5]octan-8-ylmethanol (PubChem CID 54155497) has the molecular formula C7H12O3 and a molecular weight of 144.17 g/mol. Its IUPAC name is 4,7-dioxaspiro[2.5]octan-8-ylmethanol.
| Compound Name | 4,7-dioxaspiro[2.5]octan-8-ylmethanol |
|---|---|
| PubChem CID | 54155497 |
| Molecular Formula | C7H12O3 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | 4,7-dioxaspiro[2.5]octan-8-ylmethanol |
| SMILES | OCC1OCCOC12CC2 |
| InChI | InChI=1S/C7H12O3/c8-5-6-7(1-2-7)10-4-3-9-6/h6,8H,1-5H2 |
| InChIKey | OKTLTRZPRQGIOP-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |