C7H12O4 — CID 15588101
3-methyl-1,4,6,10-tetraoxaspiro[4.5]decane (PubChem CID 15588101) has the molecular formula C7H12O4 and a molecular weight of 160.17 g/mol. Its IUPAC name is 3-methyl-1,4,6,10-tetraoxaspiro[4.5]decane.
| Compound Name | 3-methyl-1,4,6,10-tetraoxaspiro[4.5]decane |
|---|---|
| PubChem CID | 15588101 |
| Molecular Formula | C7H12O4 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | 3-methyl-1,4,6,10-tetraoxaspiro[4.5]decane |
| SMILES | CC1COC2(OCCCO2)O1 |
| InChI | InChI=1S/C7H12O4/c1-6-5-10-7(11-6)8-3-2-4-9-7/h6H,2-5H2,1H3 |
| InChIKey | AIAWXFYVJHFMHS-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |