About 5-methyl-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan
5-methyl-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan (PubChem CID 118906429) has the molecular formula C7H12O2
and a molecular weight of 128.17 g/mol. Its IUPAC name is 5-methyl-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan.
Analyze 5-methyl-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan?
The IUPAC name of 5-methyl-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan (CID 118906429) is 5-methyl-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan.
What is the SMILES notation for 5-methyl-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan?
The canonical SMILES for 5-methyl-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan is CC1CC2CCOC2O1.
What is the InChIKey of 5-methyl-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan?
The InChIKey is UANXWVVTKZAAIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2/c1-5-4-6-2-3-8-7(6)9-5/h5-7H,2-4H2,1H3.
What are the key properties of 5-methyl-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan?
5-methyl-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan has a molecular weight of 128.17 g/mol, XLogP of 1.16, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan is sourced from PubChem (CID 118906429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).