About 2,4-dimethyloxane;ethane
2,4-dimethyloxane;ethane (PubChem CID 143101228) has the molecular formula C11H26O
and a molecular weight of 174.33 g/mol. Its IUPAC name is 2,4-dimethyloxane;ethane.
Molecular Properties
| Compound Name | 2,4-dimethyloxane;ethane |
| PubChem CID | 143101228 |
| Molecular Formula | C11H26O |
| Molecular Weight | 174.33 g/mol |
| Exact Mass | 174.20 |
| IUPAC Name | 2,4-dimethyloxane;ethane |
| SMILES | CC.CC.CC1CCOC(C)C1 |
| InChI | InChI=1S/C7H14O.2C2H6/c1-6-3-4-8-7(2)5-6;2*1-2/h6-7H,3-5H2,1-2H3;2*1-2H3 |
| InChIKey | NBPSJHQBJXCOEN-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.33 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,4-dimethyloxane;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyloxane;ethane?
The IUPAC name of 2,4-dimethyloxane;ethane (CID 143101228) is 2,4-dimethyloxane;ethane.
What is the SMILES notation for 2,4-dimethyloxane;ethane?
The canonical SMILES for 2,4-dimethyloxane;ethane is CC.CC.CC1CCOC(C)C1.
What is the InChIKey of 2,4-dimethyloxane;ethane?
The InChIKey is NBPSJHQBJXCOEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O.2C2H6/c1-6-3-4-8-7(2)5-6;2*1-2/h6-7H,3-5H2,1-2H3;2*1-2H3.
What are the key properties of 2,4-dimethyloxane;ethane?
2,4-dimethyloxane;ethane has a molecular weight of 174.33 g/mol, XLogP of 3.87, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyloxane;ethane is sourced from PubChem (CID 143101228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).