C13H26O — CID 176760513
2-(2,4-dimethylpentan-3-yl)-4-methyloxane (PubChem CID 176760513) has the molecular formula C13H26O and a molecular weight of 198.35 g/mol. Its IUPAC name is 2-(2,4-dimethylpentan-3-yl)-4-methyloxane.
| Compound Name | 2-(2,4-dimethylpentan-3-yl)-4-methyloxane |
|---|---|
| PubChem CID | 176760513 |
| Molecular Formula | C13H26O |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.20 |
| IUPAC Name | 2-(2,4-dimethylpentan-3-yl)-4-methyloxane |
| SMILES | CC1CCOC(C(C(C)C)C(C)C)C1 |
| InChI | InChI=1S/C13H26O/c1-9(2)13(10(3)4)12-8-11(5)6-7-14-12/h9-13H,6-8H2,1-5H3 |
| InChIKey | NYRSHIAFAFWCDF-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |