About 2-methylpropane;4-methyl-2-propan-2-yloxane
2-methylpropane;4-methyl-2-propan-2-yloxane (PubChem CID 145025500) has the molecular formula C13H28O
and a molecular weight of 200.37 g/mol. Its IUPAC name is 2-methylpropane;4-methyl-2-propan-2-yloxane.
Molecular Properties
| Compound Name | 2-methylpropane;4-methyl-2-propan-2-yloxane |
| PubChem CID | 145025500 |
| Molecular Formula | C13H28O |
| Molecular Weight | 200.37 g/mol |
| Exact Mass | 200.21 |
| IUPAC Name | 2-methylpropane;4-methyl-2-propan-2-yloxane |
| SMILES | CC(C)C.CC1CCOC(C(C)C)C1 |
| InChI | InChI=1S/C9H18O.C4H10/c1-7(2)9-6-8(3)4-5-10-9;1-4(2)3/h7-9H,4-6H2,1-3H3;4H,1-3H3 |
| InChIKey | AZSFTTHCCUTZOV-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.37 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methylpropane;4-methyl-2-propan-2-yloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropane;4-methyl-2-propan-2-yloxane?
The IUPAC name of 2-methylpropane;4-methyl-2-propan-2-yloxane (CID 145025500) is 2-methylpropane;4-methyl-2-propan-2-yloxane.
What is the SMILES notation for 2-methylpropane;4-methyl-2-propan-2-yloxane?
The canonical SMILES for 2-methylpropane;4-methyl-2-propan-2-yloxane is CC(C)C.CC1CCOC(C(C)C)C1.
What is the InChIKey of 2-methylpropane;4-methyl-2-propan-2-yloxane?
The InChIKey is AZSFTTHCCUTZOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O.C4H10/c1-7(2)9-6-8(3)4-5-10-9;1-4(2)3/h7-9H,4-6H2,1-3H3;4H,1-3H3.
What are the key properties of 2-methylpropane;4-methyl-2-propan-2-yloxane?
2-methylpropane;4-methyl-2-propan-2-yloxane has a molecular weight of 200.37 g/mol, XLogP of 4.12, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropane;4-methyl-2-propan-2-yloxane is sourced from PubChem (CID 145025500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).